C19H15N3O3S — CID 71708125
14-propan-2-yl-10-thiophen-3-yl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11(15)-pentaene-5,12-dione (PubChem CID 71708125) has the molecular formula C19H15N3O3S and a molecular weight of 365.41 g/mol. Its IUPAC name is 14-propan-2-yl-10-thiophen-3-yl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11(15)-pentaene-5,12-dione.
| Compound Name | 14-propan-2-yl-10-thiophen-3-yl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11(15)-pentaene-5,12-dione |
|---|---|
| PubChem CID | 71708125 |
| Molecular Formula | C19H15N3O3S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 14-propan-2-yl-10-thiophen-3-yl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11(15)-pentaene-5,12-dione |
| SMILES | CC(C)n1[nH]c(=O)c2c(-c3ccsc3)c3oc4cc(=O)ccc4c3[nH]c21 |
| InChI | InChI=1S/C19H15N3O3S/c1-9(2)22-18-15(19(24)21-22)14(10-5-6-26-8-10)17-16(20-18)12-4-3-11(23)7-13(12)25-17/h3-9,20H,1-2H3,(H,21,24) |
| InChIKey | OKOFMBLGSOSSBD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |