C12H13N5S2 — CID 71709141
3-cyclobutyl-6-(2,4-dimethyl-1,3-thiazol-5-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 71709141) has the molecular formula C12H13N5S2 and a molecular weight of 291.41 g/mol. Its IUPAC name is 3-cyclobutyl-6-(2,4-dimethyl-1,3-thiazol-5-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-cyclobutyl-6-(2,4-dimethyl-1,3-thiazol-5-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 71709141 |
| Molecular Formula | C12H13N5S2 |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 3-cyclobutyl-6-(2,4-dimethyl-1,3-thiazol-5-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Cc1nc(C)c(-c2nn3c(C4CCC4)nnc3s2)s1 |
| InChI | InChI=1S/C12H13N5S2/c1-6-9(18-7(2)13-6)11-16-17-10(8-4-3-5-8)14-15-12(17)19-11/h8H,3-5H2,1-2H3 |
| InChIKey | MLQCRYHUAQJWCI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |