About 2-[(1,6-dimethyl-4-oxo-3-pyridinyl)oxy]-N-(3-methylbutyl)acetamide
2-[(1,6-dimethyl-4-oxo-3-pyridinyl)oxy]-N-(3-methylbutyl)acetamide (PubChem CID 71709654) has the molecular formula C14H22N2O3
and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-[(1,6-dimethyl-4-oxo-3-pyridinyl)oxy]-N-(3-methylbutyl)acetamide.
Molecular Properties
| Compound Name | 2-[(1,6-dimethyl-4-oxo-3-pyridinyl)oxy]-N-(3-methylbutyl)acetamide |
| PubChem CID | 71709654 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2-[(1,6-dimethyl-4-oxo-3-pyridinyl)oxy]-N-(3-methylbutyl)acetamide |
| SMILES | Cc1cc(=O)c(OCC(=O)NCCC(C)C)cn1C |
| InChI | InChI=1S/C14H22N2O3/c1-10(2)5-6-15-14(18)9-19-13-8-16(4)11(3)7-12(13)17/h7-8,10H,5-6,9H2,1-4H3,(H,15,18) |
| InChIKey | QKABLKLVONEKTK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(1,6-dimethyl-4-oxo-3-pyridinyl)oxy]-N-(3-methylbutyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,6-dimethyl-4-oxo-3-pyridinyl)oxy]-N-(3-methylbutyl)acetamide?
The IUPAC name of 2-[(1,6-dimethyl-4-oxo-3-pyridinyl)oxy]-N-(3-methylbutyl)acetamide (CID 71709654) is 2-[(1,6-dimethyl-4-oxo-3-pyridinyl)oxy]-N-(3-methylbutyl)acetamide.
What is the SMILES notation for 2-[(1,6-dimethyl-4-oxo-3-pyridinyl)oxy]-N-(3-methylbutyl)acetamide?
The canonical SMILES for 2-[(1,6-dimethyl-4-oxo-3-pyridinyl)oxy]-N-(3-methylbutyl)acetamide is Cc1cc(=O)c(OCC(=O)NCCC(C)C)cn1C.
What is the InChIKey of 2-[(1,6-dimethyl-4-oxo-3-pyridinyl)oxy]-N-(3-methylbutyl)acetamide?
The InChIKey is QKABLKLVONEKTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O3/c1-10(2)5-6-15-14(18)9-19-13-8-16(4)11(3)7-12(13)17/h7-8,10H,5-6,9H2,1-4H3,(H,15,18).
What are the key properties of 2-[(1,6-dimethyl-4-oxo-3-pyridinyl)oxy]-N-(3-methylbutyl)acetamide?
2-[(1,6-dimethyl-4-oxo-3-pyridinyl)oxy]-N-(3-methylbutyl)acetamide has a molecular weight of 266.34 g/mol, XLogP of 1.23, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,6-dimethyl-4-oxo-3-pyridinyl)oxy]-N-(3-methylbutyl)acetamide is sourced from PubChem (CID 71709654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).