C17H20FN5O2 — CID 71709742
(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-[5-fluoro-2-(tetrazol-1-yl)phenyl]methanone (PubChem CID 71709742) has the molecular formula C17H20FN5O2 and a molecular weight of 345.38 g/mol. Its IUPAC name is (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-[5-fluoro-2-(tetrazol-1-yl)phenyl]methanone.
| Compound Name | (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-[5-fluoro-2-(tetrazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 71709742 |
| Molecular Formula | C17H20FN5O2 |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-[5-fluoro-2-(tetrazol-1-yl)phenyl]methanone |
| SMILES | O=C(c1cc(F)ccc1-n1cnnn1)N1CCC2(O)CCCCC2C1 |
| InChI | InChI=1S/C17H20FN5O2/c18-13-4-5-15(23-11-19-20-21-23)14(9-13)16(24)22-8-7-17(25)6-2-1-3-12(17)10-22/h4-5,9,11-12,25H,1-3,6-8,10H2 |
| InChIKey | RJWQAWNDZDVINI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |