C19H20ClN3O — CID 71709816
2-(2-chloroquinolin-3-yl)-5,7-dimethyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one (PubChem CID 71709816) has the molecular formula C19H20ClN3O and a molecular weight of 341.84 g/mol. Its IUPAC name is 2-(2-chloroquinolin-3-yl)-5,7-dimethyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one.
| Compound Name | 2-(2-chloroquinolin-3-yl)-5,7-dimethyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one |
|---|---|
| PubChem CID | 71709816 |
| Molecular Formula | C19H20ClN3O |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 2-(2-chloroquinolin-3-yl)-5,7-dimethyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one |
| SMILES | CC12CN3CC(C)(CN(C1)C3c1cc3ccccc3nc1Cl)C2=O |
| InChI | InChI=1S/C19H20ClN3O/c1-18-8-22-10-19(2,17(18)24)11-23(9-18)16(22)13-7-12-5-3-4-6-14(12)21-15(13)20/h3-7,16H,8-11H2,1-2H3 |
| InChIKey | WFTZXOXBFJTKAX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|