C30H25N5O5 — CID 71710572
5-(2-methyl-4-nitrophenyl)-1-propan-2-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,6'-indolo[2,1-b]quinazoline]-4,6,12'-trione (PubChem CID 71710572) has the molecular formula C30H25N5O5 and a molecular weight of 535.56 g/mol. Its IUPAC name is 5-(2-methyl-4-nitrophenyl)-1-propan-2-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,6'-indolo[2,1-b]quinazoline]-4,6,12'-trione.
| Compound Name | 5-(2-methyl-4-nitrophenyl)-1-propan-2-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,6'-indolo[2,1-b]quinazoline]-4,6,12'-trione |
|---|---|
| PubChem CID | 71710572 |
| Molecular Formula | C30H25N5O5 |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | 5-(2-methyl-4-nitrophenyl)-1-propan-2-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,6'-indolo[2,1-b]quinazoline]-4,6,12'-trione |
| SMILES | Cc1cc([N+](=O)[O-])ccc1N1C(=O)C2C(C(C)C)NC3(c4ccccc4-n4c3nc3ccccc3c4=O)C2C1=O |
| InChI | InChI=1S/C30H25N5O5/c1-15(2)25-23-24(28(38)33(27(23)37)21-13-12-17(35(39)40)14-16(21)3)30(32-25)19-9-5-7-11-22(19)34-26(36)18-8-4-6-10-20(18)31-29(30)34/h4-15,23-25,32H,1-3H3 |
| InChIKey | JYCMFGODEBIGFI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 127.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|