C20H23N7O4 — CID 71710712
4-[5-(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-2,3-dihydrotetrazol-1-yl]benzohydrazide (PubChem CID 71710712) has the molecular formula C20H23N7O4 and a molecular weight of 425.45 g/mol. Its IUPAC name is 4-[5-(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-2,3-dihydrotetrazol-1-yl]benzohydrazide.
| Compound Name | 4-[5-(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-2,3-dihydrotetrazol-1-yl]benzohydrazide |
|---|---|
| PubChem CID | 71710712 |
| Molecular Formula | C20H23N7O4 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 4-[5-(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-2,3-dihydrotetrazol-1-yl]benzohydrazide |
| SMILES | COc1c2c(cc3c1C(C1=NNNN1c1ccc(C(=O)NN)cc1)N(C)CC3)OCO2 |
| InChI | InChI=1S/C20H23N7O4/c1-26-8-7-12-9-14-17(31-10-30-14)18(29-2)15(12)16(26)19-23-24-25-27(19)13-5-3-11(4-6-13)20(28)22-21/h3-6,9,16,24-25H,7-8,10,21H2,1-2H3,(H,22,28) |
| InChIKey | IDTXKAXBGUPYMZ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|