C15H12FN3O — CID 71710905
[4-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]-2-pyridinyl]methanol (PubChem CID 71710905) has the molecular formula C15H12FN3O and a molecular weight of 269.28 g/mol. Its IUPAC name is [4-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]-2-pyridinyl]methanol.
| Compound Name | [4-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 71710905 |
| Molecular Formula | C15H12FN3O |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | [4-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]-2-pyridinyl]methanol |
| SMILES | OCc1cc(-c2cn[nH]c2-c2ccc(F)cc2)ccn1 |
| InChI | InChI=1S/C15H12FN3O/c16-12-3-1-10(2-4-12)15-14(8-18-19-15)11-5-6-17-13(7-11)9-20/h1-8,20H,9H2,(H,18,19) |
| InChIKey | RKBVIYAYFDBXIL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |