C6H8F2O6 — CID 71710910
(2S,3S,4R,5R,6S)-2,6-difluoro-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 71710910) has the molecular formula C6H8F2O6 and a molecular weight of 214.12 g/mol. Its IUPAC name is (2S,3S,4R,5R,6S)-2,6-difluoro-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4R,5R,6S)-2,6-difluoro-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 71710910 |
| Molecular Formula | C6H8F2O6 |
| Molecular Weight | 214.12 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | (2S,3S,4R,5R,6S)-2,6-difluoro-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)[C@]1(F)O[C@@H](F)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H8F2O6/c7-4-2(10)1(9)3(11)6(8,14-4)5(12)13/h1-4,9-11H,(H,12,13)/t1-,2-,3+,4-,6-/m1/s1 |
| InChIKey | NQKZMBDISJYOPD-ORELYVPDSA-N |
| XLogP | -1.85 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.12 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |