C17H11F2NO2 — CID 71710917
5,6-bis(4-fluorophenyl)-3-hydroxy-1H-pyridin-2-one (PubChem CID 71710917) has the molecular formula C17H11F2NO2 and a molecular weight of 299.28 g/mol. Its IUPAC name is 5,6-bis(4-fluorophenyl)-3-hydroxy-1H-pyridin-2-one.
| Compound Name | 5,6-bis(4-fluorophenyl)-3-hydroxy-1H-pyridin-2-one |
|---|---|
| PubChem CID | 71710917 |
| Molecular Formula | C17H11F2NO2 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 5,6-bis(4-fluorophenyl)-3-hydroxy-1H-pyridin-2-one |
| SMILES | O=c1[nH]c(-c2ccc(F)cc2)c(-c2ccc(F)cc2)cc1O |
| InChI | InChI=1S/C17H11F2NO2/c18-12-5-1-10(2-6-12)14-9-15(21)17(22)20-16(14)11-3-7-13(19)8-4-11/h1-9,21H,(H,20,22) |
| InChIKey | CIZBXDSIEHHRKM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |