C9H13ClN2 — CID 71711078
1,2,3,4-tetrahydroquinolin-8-amine;hydrochloride (PubChem CID 71711078) has the molecular formula C9H13ClN2 and a molecular weight of 184.67 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroquinolin-8-amine;hydrochloride.
| Compound Name | 1,2,3,4-tetrahydroquinolin-8-amine;hydrochloride |
|---|---|
| PubChem CID | 71711078 |
| Molecular Formula | C9H13ClN2 |
| Molecular Weight | 184.67 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 1,2,3,4-tetrahydroquinolin-8-amine;hydrochloride |
| SMILES | Cl.Nc1cccc2c1NCCC2 |
| InChI | InChI=1S/C9H12N2.ClH/c10-8-5-1-3-7-4-2-6-11-9(7)8;/h1,3,5,11H,2,4,6,10H2;1H |
| InChIKey | DLTPSLJLSVMXHE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.67 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|