About 3-aminocyclopentan-1-one;hydrochloride
3-aminocyclopentan-1-one;hydrochloride (PubChem CID 71711093) has the molecular formula C5H10ClNO
and a molecular weight of 135.59 g/mol. Its IUPAC name is 3-aminocyclopentan-1-one;hydrochloride.
Molecular Properties
| Compound Name | 3-aminocyclopentan-1-one;hydrochloride |
| PubChem CID | 71711093 |
| Molecular Formula | C5H10ClNO |
| Molecular Weight | 135.59 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | 3-aminocyclopentan-1-one;hydrochloride |
| SMILES | Cl.NC1CCC(=O)C1 |
| InChI | InChI=1S/C5H9NO.ClH/c6-4-1-2-5(7)3-4;/h4H,1-3,6H2;1H |
| InChIKey | PVSCKQDMLUSTHY-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.59 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-aminocyclopentan-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminocyclopentan-1-one;hydrochloride?
The IUPAC name of 3-aminocyclopentan-1-one;hydrochloride (CID 71711093) is 3-aminocyclopentan-1-one;hydrochloride.
What is the SMILES notation for 3-aminocyclopentan-1-one;hydrochloride?
The canonical SMILES for 3-aminocyclopentan-1-one;hydrochloride is Cl.NC1CCC(=O)C1.
What is the InChIKey of 3-aminocyclopentan-1-one;hydrochloride?
The InChIKey is PVSCKQDMLUSTHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.ClH/c6-4-1-2-5(7)3-4;/h4H,1-3,6H2;1H.
What are the key properties of 3-aminocyclopentan-1-one;hydrochloride?
3-aminocyclopentan-1-one;hydrochloride has a molecular weight of 135.59 g/mol, XLogP of 0.49, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminocyclopentan-1-one;hydrochloride is sourced from PubChem (CID 71711093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).