C15H27N3O — CID 71711276
N,N-diethyl-4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yloxy)butan-1-amine (PubChem CID 71711276) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is N,N-diethyl-4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yloxy)butan-1-amine.
| Compound Name | N,N-diethyl-4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yloxy)butan-1-amine |
|---|---|
| PubChem CID | 71711276 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | N,N-diethyl-4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yloxy)butan-1-amine |
| SMILES | CCN(CC)CCCCOc1cc2n(n1)CCCC2 |
| InChI | InChI=1S/C15H27N3O/c1-3-17(4-2)10-7-8-12-19-15-13-14-9-5-6-11-18(14)16-15/h13H,3-12H2,1-2H3 |
| InChIKey | JTTUZDJGMKBBBT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|