C25H26ClNO4S — CID 71711327
2-[6-chloro-4-[4-(cyclohexylsulfamoyl)phenyl]-3-methylnaphthalen-2-yl]acetic acid (PubChem CID 71711327) has the molecular formula C25H26ClNO4S and a molecular weight of 472.01 g/mol. Its IUPAC name is 2-[6-chloro-4-[4-(cyclohexylsulfamoyl)phenyl]-3-methylnaphthalen-2-yl]acetic acid.
| Compound Name | 2-[6-chloro-4-[4-(cyclohexylsulfamoyl)phenyl]-3-methylnaphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 71711327 |
| Molecular Formula | C25H26ClNO4S |
| Molecular Weight | 472.01 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 2-[6-chloro-4-[4-(cyclohexylsulfamoyl)phenyl]-3-methylnaphthalen-2-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)cc2ccc(Cl)cc2c1-c1ccc(S(=O)(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C25H26ClNO4S/c1-16-19(14-24(28)29)13-18-7-10-20(26)15-23(18)25(16)17-8-11-22(12-9-17)32(30,31)27-21-5-3-2-4-6-21/h7-13,15,21,27H,2-6,14H2,1H3,(H,28,29) |
| InChIKey | QSKPDDMBZVXLAN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.01 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |