C24H22F3N5O3S — CID 71711366
N-pyrazin-2-yl-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)-4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzoxazine-7-sulfonamide (PubChem CID 71711366) has the molecular formula C24H22F3N5O3S and a molecular weight of 517.53 g/mol. Its IUPAC name is N-pyrazin-2-yl-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)-4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzoxazine-7-sulfonamide.
| Compound Name | N-pyrazin-2-yl-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)-4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzoxazine-7-sulfonamide |
|---|---|
| PubChem CID | 71711366 |
| Molecular Formula | C24H22F3N5O3S |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | N-pyrazin-2-yl-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)-4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzoxazine-7-sulfonamide |
| SMILES | O=S(=O)(Nc1cnccn1)c1ccc2c(c1)OCCN2c1ccc(C(F)(F)F)cc1C1=CCNCC1 |
| InChI | InChI=1S/C24H22F3N5O3S/c25-24(26,27)17-1-3-20(19(13-17)16-5-7-28-8-6-16)32-11-12-35-22-14-18(2-4-21(22)32)36(33,34)31-23-15-29-9-10-30-23/h1-5,9-10,13-15,28H,6-8,11-12H2,(H,30,31) |
| InChIKey | BGUFQRBNZSKULL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |