C25H23F3N4O3S — CID 71711487
N-pyridin-2-yl-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)-4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzoxazine-7-sulfonamide (PubChem CID 71711487) has the molecular formula C25H23F3N4O3S and a molecular weight of 516.55 g/mol. Its IUPAC name is N-pyridin-2-yl-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)-4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzoxazine-7-sulfonamide.
| Compound Name | N-pyridin-2-yl-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)-4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzoxazine-7-sulfonamide |
|---|---|
| PubChem CID | 71711487 |
| Molecular Formula | C25H23F3N4O3S |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | N-pyridin-2-yl-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)-4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzoxazine-7-sulfonamide |
| SMILES | O=S(=O)(Nc1ccccn1)c1ccc2c(c1)OCCN2c1ccc(C(F)(F)F)cc1C1=CCNCC1 |
| InChI | InChI=1S/C25H23F3N4O3S/c26-25(27,28)18-4-6-21(20(15-18)17-8-11-29-12-9-17)32-13-14-35-23-16-19(5-7-22(23)32)36(33,34)31-24-3-1-2-10-30-24/h1-8,10,15-16,29H,9,11-14H2,(H,30,31) |
| InChIKey | NSYUCGKTZVAHSF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |