C18H14F3N3O2S — CID 71711842
5-(4-methylsulfonylphenyl)-3-[4-(trifluoromethyl)phenyl]pyrazin-2-amine (PubChem CID 71711842) has the molecular formula C18H14F3N3O2S and a molecular weight of 393.39 g/mol. Its IUPAC name is 5-(4-methylsulfonylphenyl)-3-[4-(trifluoromethyl)phenyl]pyrazin-2-amine.
| Compound Name | 5-(4-methylsulfonylphenyl)-3-[4-(trifluoromethyl)phenyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 71711842 |
| Molecular Formula | C18H14F3N3O2S |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 5-(4-methylsulfonylphenyl)-3-[4-(trifluoromethyl)phenyl]pyrazin-2-amine |
| SMILES | CS(=O)(=O)c1ccc(-c2cnc(N)c(-c3ccc(C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C18H14F3N3O2S/c1-27(25,26)14-8-4-11(5-9-14)15-10-23-17(22)16(24-15)12-2-6-13(7-3-12)18(19,20)21/h2-10H,1H3,(H2,22,23) |
| InChIKey | FRRKZFCMZMHXEM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |