C15H12N2O2S — CID 71712439
2-[2-(2-methoxyphenyl)ethynyl]-6,7-dihydro-5H-[1,3]thiazolo[5,4-c]pyridin-4-one (PubChem CID 71712439) has the molecular formula C15H12N2O2S and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-[2-(2-methoxyphenyl)ethynyl]-6,7-dihydro-5H-[1,3]thiazolo[5,4-c]pyridin-4-one.
| Compound Name | 2-[2-(2-methoxyphenyl)ethynyl]-6,7-dihydro-5H-[1,3]thiazolo[5,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 71712439 |
| Molecular Formula | C15H12N2O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-[2-(2-methoxyphenyl)ethynyl]-6,7-dihydro-5H-[1,3]thiazolo[5,4-c]pyridin-4-one |
| SMILES | COc1ccccc1C#Cc1nc2c(s1)C(=O)NCC2 |
| InChI | InChI=1S/C15H12N2O2S/c1-19-12-5-3-2-4-10(12)6-7-13-17-11-8-9-16-15(18)14(11)20-13/h2-5H,8-9H2,1H3,(H,16,18) |
| InChIKey | SDVOZACPIDOGAV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|