C18H24N4OS — CID 71712563
1-(8-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)-3-[3-(5-methylimidazol-1-yl)propyl]thiourea (PubChem CID 71712563) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is 1-(8-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)-3-[3-(5-methylimidazol-1-yl)propyl]thiourea.
| Compound Name | 1-(8-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)-3-[3-(5-methylimidazol-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 71712563 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-(8-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)-3-[3-(5-methylimidazol-1-yl)propyl]thiourea |
| SMILES | Cc1cncn1CCCNC(=S)Nc1ccc2c(c1)C(O)CCC2 |
| InChI | InChI=1S/C18H24N4OS/c1-13-11-19-12-22(13)9-3-8-20-18(24)21-15-7-6-14-4-2-5-17(23)16(14)10-15/h6-7,10-12,17,23H,2-5,8-9H2,1H3,(H2,20,21,24) |
| InChIKey | AFCNSMCLJHZSBR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|