C28H29FO6 — CID 71712575
[4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenyl] 4-fluorobenzoate (PubChem CID 71712575) has the molecular formula C28H29FO6 and a molecular weight of 480.53 g/mol. Its IUPAC name is [4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenyl] 4-fluorobenzoate.
| Compound Name | [4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 71712575 |
| Molecular Formula | C28H29FO6 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | [4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenyl] 4-fluorobenzoate |
| SMILES | COc1ccc(C[C@H]2COC[C@@H]2Cc2ccc(OC(=O)c3ccc(F)cc3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C28H29FO6/c1-31-24-10-4-18(14-26(24)32-2)12-21-16-34-17-22(21)13-19-5-11-25(27(15-19)33-3)35-28(30)20-6-8-23(29)9-7-20/h4-11,14-15,21-22H,12-13,16-17H2,1-3H3/t21-,22-/m0/s1 |
| InChIKey | RVRXJKXMQQXPAJ-VXKWHMMOSA-N |
| XLogP | 5.12 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|