C35H33NOSi — CID 71712617
[diphenyl-[(2R)-pyrrolidin-2-yl]methoxy]-triphenylsilane (PubChem CID 71712617) has the molecular formula C35H33NOSi and a molecular weight of 511.74 g/mol. Its IUPAC name is [diphenyl-[(2R)-pyrrolidin-2-yl]methoxy]-triphenylsilane.
| Compound Name | [diphenyl-[(2R)-pyrrolidin-2-yl]methoxy]-triphenylsilane |
|---|---|
| PubChem CID | 71712617 |
| Molecular Formula | C35H33NOSi |
| Molecular Weight | 511.74 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | [diphenyl-[(2R)-pyrrolidin-2-yl]methoxy]-triphenylsilane |
| SMILES | c1ccc(C(O[Si](c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)[C@H]2CCCN2)cc1 |
| InChI | InChI=1S/C35H33NOSi/c1-6-17-29(18-7-1)35(34-27-16-28-36-34,30-19-8-2-9-20-30)37-38(31-21-10-3-11-22-31,32-23-12-4-13-24-32)33-25-14-5-15-26-33/h1-15,17-26,34,36H,16,27-28H2/t34-/m1/s1 |
| InChIKey | DXLGKWBEDOVQRE-UUWRZZSWSA-N |
| XLogP | 5.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.74 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|