C27H29NO6 — CID 71712722
[4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenyl] pyridine-3-carboxylate (PubChem CID 71712722) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is [4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenyl] pyridine-3-carboxylate.
| Compound Name | [4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 71712722 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | [4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenyl] pyridine-3-carboxylate |
| SMILES | COc1ccc(C[C@H]2COC[C@@H]2Cc2ccc(OC(=O)c3cccnc3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C27H29NO6/c1-30-23-8-6-18(13-25(23)31-2)11-21-16-33-17-22(21)12-19-7-9-24(26(14-19)32-3)34-27(29)20-5-4-10-28-15-20/h4-10,13-15,21-22H,11-12,16-17H2,1-3H3/t21-,22-/m0/s1 |
| InChIKey | NBJZYJYHRLQGQO-VXKWHMMOSA-N |
| XLogP | 4.37 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|