C26H28O7 — CID 71712723
[4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenyl] furan-2-carboxylate (PubChem CID 71712723) has the molecular formula C26H28O7 and a molecular weight of 452.50 g/mol. Its IUPAC name is [4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenyl] furan-2-carboxylate.
| Compound Name | [4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 71712723 |
| Molecular Formula | C26H28O7 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | [4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenyl] furan-2-carboxylate |
| SMILES | COc1ccc(C[C@H]2COC[C@@H]2Cc2ccc(OC(=O)c3ccco3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C26H28O7/c1-28-21-8-6-17(13-24(21)29-2)11-19-15-31-16-20(19)12-18-7-9-22(25(14-18)30-3)33-26(27)23-5-4-10-32-23/h4-10,13-14,19-20H,11-12,15-16H2,1-3H3/t19-,20-/m0/s1 |
| InChIKey | QUYUEWPTJHPDMY-PMACEKPBSA-N |
| XLogP | 4.57 |
| TPSA | 76.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|