C19H22N2S — CID 71712730
5-(3-methylbutyl)-2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine (PubChem CID 71712730) has the molecular formula C19H22N2S and a molecular weight of 310.47 g/mol. Its IUPAC name is 5-(3-methylbutyl)-2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine.
| Compound Name | 5-(3-methylbutyl)-2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 71712730 |
| Molecular Formula | C19H22N2S |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 5-(3-methylbutyl)-2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine |
| SMILES | CC(C)CCN1CCc2nc(C#Cc3ccccc3)sc2C1 |
| InChI | InChI=1S/C19H22N2S/c1-15(2)10-12-21-13-11-17-18(14-21)22-19(20-17)9-8-16-6-4-3-5-7-16/h3-7,15H,10-14H2,1-2H3 |
| InChIKey | BAAXXHKRHDLZMK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|