C18H20N2S — CID 71712731
5-(2-methylpropyl)-2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine (PubChem CID 71712731) has the molecular formula C18H20N2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 5-(2-methylpropyl)-2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine.
| Compound Name | 5-(2-methylpropyl)-2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 71712731 |
| Molecular Formula | C18H20N2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 5-(2-methylpropyl)-2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine |
| SMILES | CC(C)CN1CCc2nc(C#Cc3ccccc3)sc2C1 |
| InChI | InChI=1S/C18H20N2S/c1-14(2)12-20-11-10-16-17(13-20)21-18(19-16)9-8-15-6-4-3-5-7-15/h3-7,14H,10-13H2,1-2H3 |
| InChIKey | GEGODDDJGHCCEK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|