C18H17FN2S — CID 71712732
5-cyclobutyl-2-[2-(3-fluorophenyl)ethynyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine (PubChem CID 71712732) has the molecular formula C18H17FN2S and a molecular weight of 312.41 g/mol. Its IUPAC name is 5-cyclobutyl-2-[2-(3-fluorophenyl)ethynyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine.
| Compound Name | 5-cyclobutyl-2-[2-(3-fluorophenyl)ethynyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 71712732 |
| Molecular Formula | C18H17FN2S |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 5-cyclobutyl-2-[2-(3-fluorophenyl)ethynyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine |
| SMILES | Fc1cccc(C#Cc2nc3c(s2)CN(C2CCC2)CC3)c1 |
| InChI | InChI=1S/C18H17FN2S/c19-14-4-1-3-13(11-14)7-8-18-20-16-9-10-21(12-17(16)22-18)15-5-2-6-15/h1,3-4,11,15H,2,5-6,9-10,12H2 |
| InChIKey | RIBGQZYTHLVWHH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|