C19H19FN2S — CID 71712733
5-cyclopentyl-2-[2-(3-fluorophenyl)ethynyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine (PubChem CID 71712733) has the molecular formula C19H19FN2S and a molecular weight of 326.44 g/mol. Its IUPAC name is 5-cyclopentyl-2-[2-(3-fluorophenyl)ethynyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine.
| Compound Name | 5-cyclopentyl-2-[2-(3-fluorophenyl)ethynyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 71712733 |
| Molecular Formula | C19H19FN2S |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 5-cyclopentyl-2-[2-(3-fluorophenyl)ethynyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine |
| SMILES | Fc1cccc(C#Cc2nc3c(s2)CN(C2CCCC2)CC3)c1 |
| InChI | InChI=1S/C19H19FN2S/c20-15-5-3-4-14(12-15)8-9-19-21-17-10-11-22(13-18(17)23-19)16-6-1-2-7-16/h3-5,12,16H,1-2,6-7,10-11,13H2 |
| InChIKey | QEBQNZBNTROKNX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|