C18H16N2OS — CID 71712879
cyclopropyl-[2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]methanone (PubChem CID 71712879) has the molecular formula C18H16N2OS and a molecular weight of 308.41 g/mol. Its IUPAC name is cyclopropyl-[2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]methanone.
| Compound Name | cyclopropyl-[2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 71712879 |
| Molecular Formula | C18H16N2OS |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | cyclopropyl-[2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]methanone |
| SMILES | O=C(C1CC1)N1CCc2nc(C#Cc3ccccc3)sc2C1 |
| InChI | InChI=1S/C18H16N2OS/c21-18(14-7-8-14)20-11-10-15-16(12-20)22-17(19-15)9-6-13-4-2-1-3-5-13/h1-5,14H,7-8,10-12H2 |
| InChIKey | JMCWYXPRTOXLSG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|