C27H28N2O4 — CID 71712903
3-[4-[[[3-[[benzoyl(ethyl)amino]methyl]benzoyl]amino]methyl]phenyl]propanoic acid (PubChem CID 71712903) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is 3-[4-[[[3-[[benzoyl(ethyl)amino]methyl]benzoyl]amino]methyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[[[3-[[benzoyl(ethyl)amino]methyl]benzoyl]amino]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 71712903 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 3-[4-[[[3-[[benzoyl(ethyl)amino]methyl]benzoyl]amino]methyl]phenyl]propanoic acid |
| SMILES | CCN(Cc1cccc(C(=O)NCc2ccc(CCC(=O)O)cc2)c1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C27H28N2O4/c1-2-29(27(33)23-8-4-3-5-9-23)19-22-7-6-10-24(17-22)26(32)28-18-21-13-11-20(12-14-21)15-16-25(30)31/h3-14,17H,2,15-16,18-19H2,1H3,(H,28,32)(H,30,31) |
| InChIKey | RGODLJWLMHYDJI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |