About (3S,4R)-1-benzyl-N,4-diphenylpyrrolidin-3-amine;hydrochloride
(3S,4R)-1-benzyl-N,4-diphenylpyrrolidin-3-amine;hydrochloride (PubChem CID 71713046) has the molecular formula C23H25ClN2
and a molecular weight of 364.92 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-N,4-diphenylpyrrolidin-3-amine;hydrochloride.
Molecular Properties
| Compound Name | (3S,4R)-1-benzyl-N,4-diphenylpyrrolidin-3-amine;hydrochloride |
| PubChem CID | 71713046 |
| Molecular Formula | C23H25ClN2 |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (3S,4R)-1-benzyl-N,4-diphenylpyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.c1ccc(CN2C[C@@H](Nc3ccccc3)[C@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C23H24N2.ClH/c1-4-10-19(11-5-1)16-25-17-22(20-12-6-2-7-13-20)23(18-25)24-21-14-8-3-9-15-21;/h1-15,22-24H,16-18H2;1H/t22-,23+;/m0./s1 |
| InChIKey | OOAFXCXFTPFPIS-PEADMDKFSA-N |
| XLogP | 5.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,4R)-1-benzyl-N,4-diphenylpyrrolidin-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-1-benzyl-N,4-diphenylpyrrolidin-3-amine;hydrochloride?
The IUPAC name of (3S,4R)-1-benzyl-N,4-diphenylpyrrolidin-3-amine;hydrochloride (CID 71713046) is (3S,4R)-1-benzyl-N,4-diphenylpyrrolidin-3-amine;hydrochloride.
What is the SMILES notation for (3S,4R)-1-benzyl-N,4-diphenylpyrrolidin-3-amine;hydrochloride?
The canonical SMILES for (3S,4R)-1-benzyl-N,4-diphenylpyrrolidin-3-amine;hydrochloride is Cl.c1ccc(CN2C[C@@H](Nc3ccccc3)[C@H](c3ccccc3)C2)cc1.
What is the InChIKey of (3S,4R)-1-benzyl-N,4-diphenylpyrrolidin-3-amine;hydrochloride?
The InChIKey is OOAFXCXFTPFPIS-PEADMDKFSA-N. The full InChI is InChI=1S/C23H24N2.ClH/c1-4-10-19(11-5-1)16-25-17-22(20-12-6-2-7-13-20)23(18-25)24-21-14-8-3-9-15-21;/h1-15,22-24H,16-18H2;1H/t22-,23+;/m0./s1.
What are the key properties of (3S,4R)-1-benzyl-N,4-diphenylpyrrolidin-3-amine;hydrochloride?
(3S,4R)-1-benzyl-N,4-diphenylpyrrolidin-3-amine;hydrochloride has a molecular weight of 364.92 g/mol, XLogP of 5.19, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-1-benzyl-N,4-diphenylpyrrolidin-3-amine;hydrochloride is sourced from PubChem (CID 71713046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).