About (E)-dec-8-en-4,6-diyne-1,2,10-triol
(E)-dec-8-en-4,6-diyne-1,2,10-triol (PubChem CID 71713234) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is (E)-dec-8-en-4,6-diyne-1,2,10-triol.
Molecular Properties
| Compound Name | (E)-dec-8-en-4,6-diyne-1,2,10-triol |
| PubChem CID | 71713234 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (E)-dec-8-en-4,6-diyne-1,2,10-triol |
| SMILES | OC/C=C/C#CC#CCC(O)CO |
| InChI | InChI=1S/C10H12O3/c11-8-6-4-2-1-3-5-7-10(13)9-12/h4,6,10-13H,7-9H2/b6-4+ |
| InChIKey | OBLUVUJNAGOBPQ-GQCTYLIASA-N |
| XLogP | -0.71 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-dec-8-en-4,6-diyne-1,2,10-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-dec-8-en-4,6-diyne-1,2,10-triol?
The IUPAC name of (E)-dec-8-en-4,6-diyne-1,2,10-triol (CID 71713234) is (E)-dec-8-en-4,6-diyne-1,2,10-triol.
What is the SMILES notation for (E)-dec-8-en-4,6-diyne-1,2,10-triol?
The canonical SMILES for (E)-dec-8-en-4,6-diyne-1,2,10-triol is OC/C=C/C#CC#CCC(O)CO.
What is the InChIKey of (E)-dec-8-en-4,6-diyne-1,2,10-triol?
The InChIKey is OBLUVUJNAGOBPQ-GQCTYLIASA-N. The full InChI is InChI=1S/C10H12O3/c11-8-6-4-2-1-3-5-7-10(13)9-12/h4,6,10-13H,7-9H2/b6-4+.
What are the key properties of (E)-dec-8-en-4,6-diyne-1,2,10-triol?
(E)-dec-8-en-4,6-diyne-1,2,10-triol has a molecular weight of 180.20 g/mol, XLogP of -0.71, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-dec-8-en-4,6-diyne-1,2,10-triol is sourced from PubChem (CID 71713234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).