C23H27NO3Si — CID 71713268
(2S,3aR,4S,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-2-phenyl-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-6-one (PubChem CID 71713268) has the molecular formula C23H27NO3Si and a molecular weight of 393.56 g/mol. Its IUPAC name is (2S,3aR,4S,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-2-phenyl-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-6-one.
| Compound Name | (2S,3aR,4S,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-2-phenyl-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-6-one |
|---|---|
| PubChem CID | 71713268 |
| Molecular Formula | C23H27NO3Si |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | (2S,3aR,4S,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-2-phenyl-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizin-6-one |
| SMILES | C[Si](C)(C[C@@H]1[C@H]2O[C@@H](c3ccccc3)O[C@H]2[C@H]2CCC(=O)N21)c1ccccc1 |
| InChI | InChI=1S/C23H27NO3Si/c1-28(2,17-11-7-4-8-12-17)15-19-22-21(18-13-14-20(25)24(18)19)26-23(27-22)16-9-5-3-6-10-16/h3-12,18-19,21-23H,13-15H2,1-2H3/t18-,19-,21+,22-,23+/m1/s1 |
| InChIKey | KPTCRPRTCBARPS-KRQRVDPASA-N |
| XLogP | 3.46 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|