C22H18N2OS — CID 71713325
(3-methylphenyl)-[2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]methanone (PubChem CID 71713325) has the molecular formula C22H18N2OS and a molecular weight of 358.47 g/mol. Its IUPAC name is (3-methylphenyl)-[2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]methanone.
| Compound Name | (3-methylphenyl)-[2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 71713325 |
| Molecular Formula | C22H18N2OS |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (3-methylphenyl)-[2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]methanone |
| SMILES | Cc1cccc(C(=O)N2CCc3nc(C#Cc4ccccc4)sc3C2)c1 |
| InChI | InChI=1S/C22H18N2OS/c1-16-6-5-9-18(14-16)22(25)24-13-12-19-20(15-24)26-21(23-19)11-10-17-7-3-2-4-8-17/h2-9,14H,12-13,15H2,1H3 |
| InChIKey | JAHVHQRYTRNSNM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|