About N-[(3S,4R)-1-benzyl-4-cyclohexylpyrrolidin-3-yl]cyclohexanecarboxamide
N-[(3S,4R)-1-benzyl-4-cyclohexylpyrrolidin-3-yl]cyclohexanecarboxamide (PubChem CID 71713352) has the molecular formula C24H36N2O
and a molecular weight of 368.57 g/mol. Its IUPAC name is N-[(3S,4R)-1-benzyl-4-cyclohexylpyrrolidin-3-yl]cyclohexanecarboxamide.
Molecular Properties
| Compound Name | N-[(3S,4R)-1-benzyl-4-cyclohexylpyrrolidin-3-yl]cyclohexanecarboxamide |
| PubChem CID | 71713352 |
| Molecular Formula | C24H36N2O |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | N-[(3S,4R)-1-benzyl-4-cyclohexylpyrrolidin-3-yl]cyclohexanecarboxamide |
| SMILES | O=C(N[C@@H]1CN(Cc2ccccc2)C[C@H]1C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C24H36N2O/c27-24(21-14-8-3-9-15-21)25-23-18-26(16-19-10-4-1-5-11-19)17-22(23)20-12-6-2-7-13-20/h1,4-5,10-11,20-23H,2-3,6-9,12-18H2,(H,25,27)/t22-,23+/m0/s1 |
| InChIKey | HVPHDMFQQWNTIG-XZOQPEGZSA-N |
| XLogP | 4.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(3S,4R)-1-benzyl-4-cyclohexylpyrrolidin-3-yl]cyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S,4R)-1-benzyl-4-cyclohexylpyrrolidin-3-yl]cyclohexanecarboxamide?
The IUPAC name of N-[(3S,4R)-1-benzyl-4-cyclohexylpyrrolidin-3-yl]cyclohexanecarboxamide (CID 71713352) is N-[(3S,4R)-1-benzyl-4-cyclohexylpyrrolidin-3-yl]cyclohexanecarboxamide.
What is the SMILES notation for N-[(3S,4R)-1-benzyl-4-cyclohexylpyrrolidin-3-yl]cyclohexanecarboxamide?
The canonical SMILES for N-[(3S,4R)-1-benzyl-4-cyclohexylpyrrolidin-3-yl]cyclohexanecarboxamide is O=C(N[C@@H]1CN(Cc2ccccc2)C[C@H]1C1CCCCC1)C1CCCCC1.
What is the InChIKey of N-[(3S,4R)-1-benzyl-4-cyclohexylpyrrolidin-3-yl]cyclohexanecarboxamide?
The InChIKey is HVPHDMFQQWNTIG-XZOQPEGZSA-N. The full InChI is InChI=1S/C24H36N2O/c27-24(21-14-8-3-9-15-21)25-23-18-26(16-19-10-4-1-5-11-19)17-22(23)20-12-6-2-7-13-20/h1,4-5,10-11,20-23H,2-3,6-9,12-18H2,(H,25,27)/t22-,23+/m0/s1.
What are the key properties of N-[(3S,4R)-1-benzyl-4-cyclohexylpyrrolidin-3-yl]cyclohexanecarboxamide?
N-[(3S,4R)-1-benzyl-4-cyclohexylpyrrolidin-3-yl]cyclohexanecarboxamide has a molecular weight of 368.57 g/mol, XLogP of 4.76, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S,4R)-1-benzyl-4-cyclohexylpyrrolidin-3-yl]cyclohexanecarboxamide is sourced from PubChem (CID 71713352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).