C31H37NO3Si — CID 71713373
[(2S,3aR,4S,6S,8aR,8bS)-2-phenyl-6-(phenylmethoxymethyl)-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-4-yl]methyl-dimethyl-phenylsilane (PubChem CID 71713373) has the molecular formula C31H37NO3Si and a molecular weight of 499.73 g/mol. Its IUPAC name is [(2S,3aR,4S,6S,8aR,8bS)-2-phenyl-6-(phenylmethoxymethyl)-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-4-yl]methyl-dimethyl-phenylsilane.
| Compound Name | [(2S,3aR,4S,6S,8aR,8bS)-2-phenyl-6-(phenylmethoxymethyl)-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-4-yl]methyl-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 71713373 |
| Molecular Formula | C31H37NO3Si |
| Molecular Weight | 499.73 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | [(2S,3aR,4S,6S,8aR,8bS)-2-phenyl-6-(phenylmethoxymethyl)-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-4-yl]methyl-dimethyl-phenylsilane |
| SMILES | C[Si](C)(C[C@@H]1[C@H]2O[C@@H](c3ccccc3)O[C@H]2[C@H]2CC[C@@H](COCc3ccccc3)N21)c1ccccc1 |
| InChI | InChI=1S/C31H37NO3Si/c1-36(2,26-16-10-5-11-17-26)22-28-30-29(34-31(35-30)24-14-8-4-9-15-24)27-19-18-25(32(27)28)21-33-20-23-12-6-3-7-13-23/h3-17,25,27-31H,18-22H2,1-2H3/t25-,27+,28+,29-,30+,31-/m0/s1 |
| InChIKey | KISORFAXYJPPKK-MBLGCPJISA-N |
| XLogP | 5.52 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.73 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|