About CID 71713496
CID 71713496 (PubChem CID 71713496) has the molecular formula C14H14FeO+2
and a molecular weight of 254.11 g/mol.
Molecular Properties
| Compound Name | CID 71713496 |
| PubChem CID | 71713496 |
| Molecular Formula | C14H14FeO+2 |
| Molecular Weight | 254.11 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | — |
| SMILES | CC(=O)/C=C/[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C9H9O.C5H5.Fe/c1-8(10)6-7-9-4-2-3-5-9;1-2-4-5-3-1;/h2-7H,1H3;1-5H;/q;;+2/b7-6+;; |
| InChIKey | SQCBKNQUDYZQLD-KMXZHCNGSA-N |
| XLogP | 2.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.11 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 71713496 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71713496?
The IUPAC name of CID 71713496 (CID 71713496) is not available.
What is the SMILES notation for CID 71713496?
The canonical SMILES for CID 71713496 is CC(=O)/C=C/[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 71713496?
The InChIKey is SQCBKNQUDYZQLD-KMXZHCNGSA-N. The full InChI is InChI=1S/C9H9O.C5H5.Fe/c1-8(10)6-7-9-4-2-3-5-9;1-2-4-5-3-1;/h2-7H,1H3;1-5H;/q;;+2/b7-6+;;.
What are the key properties of CID 71713496?
CID 71713496 has a molecular weight of 254.11 g/mol, XLogP of 2.56, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71713496 is sourced from PubChem (CID 71713496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).