About CID 71713668
CID 71713668 (PubChem CID 71713668) has the molecular formula C99H138N2O2Si2
and a molecular weight of 1444.38 g/mol.
Molecular Properties
| Compound Name | CID 71713668 |
| PubChem CID | 71713668 |
| Molecular Formula | C99H138N2O2Si2 |
| Molecular Weight | 1444.38 g/mol |
| Exact Mass | 1443.03 |
| IUPAC Name | — |
| SMILES | CC(C)c1ccc(-c2cc(-c3c(C(C)C)cc(C(C)C)cc3C(C)C)cc(-c3c(C(C)C)cc(C(C)C)cc3C(C)C)c2N2[Si]N(c3c(-c4c(C(C)C)cc(C(C)C)cc4C(C)C)cc(-c4c(C(C)C)cc(C(C)C)cc4C(C)C)cc3-c3c(C(C)C)cc(C(C)C)cc3C(C)C)[Si]2(O)O)c(C(C)C)c1 |
| InChI | InChI=1S/C99H138N2O2Si2/c1-52(2)69-35-36-77(78(37-69)58(13)14)89-48-75(93-79(59(15)16)38-70(53(3)4)39-80(93)60(17)18)49-90(95-83(63(23)24)42-72(55(7)8)43-84(95)64(25)26)98(89)100-104-101(105(100,102)103)99-91(96-85(65(27)28)44-73(56(9)10)45-86(96)66(29)30)50-76(94-81(61(19)20)40-71(54(5)6)41-82(94)62(21)22)51-92(99)97-87(67(31)32)46-74(57(11)12)47-88(97)68(33)34/h35-68,102-103H,1-34H3 |
| InChIKey | VPKDZYUXSBZTNF-UHFFFAOYSA-N |
| XLogP | 30.07 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 105 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1444.38 |
| LogP ≤ 5 | 30.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 71713668 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71713668?
The IUPAC name of CID 71713668 (CID 71713668) is not available.
What is the SMILES notation for CID 71713668?
The canonical SMILES for CID 71713668 is CC(C)c1ccc(-c2cc(-c3c(C(C)C)cc(C(C)C)cc3C(C)C)cc(-c3c(C(C)C)cc(C(C)C)cc3C(C)C)c2N2[Si]N(c3c(-c4c(C(C)C)cc(C(C)C)cc4C(C)C)cc(-c4c(C(C)C)cc(C(C)C)cc4C(C)C)cc3-c3c(C(C)C)cc(C(C)C)cc3C(C)C)[Si]2(O)O)c(C(C)C)c1.
What is the InChIKey of CID 71713668?
The InChIKey is VPKDZYUXSBZTNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C99H138N2O2Si2/c1-52(2)69-35-36-77(78(37-69)58(13)14)89-48-75(93-79(59(15)16)38-70(53(3)4)39-80(93)60(17)18)49-90(95-83(63(23)24)42-72(55(7)8)43-84(95)64(25)26)98(89)100-104-101(105(100,102)103)99-91(96-85(65(27)28)44-73(56(9)10)45-86(96)66(29)30)50-76(94-81(61(19)20)40-71(54(5)6)41-82(94)62(21)22)51-92(99)97-87(67(31)32)46-74(57(11)12)47-88(97)68(33)34/h35-68,102-103H,1-34H3.
What are the key properties of CID 71713668?
CID 71713668 has a molecular weight of 1444.38 g/mol, XLogP of 30.07, 25 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71713668 is sourced from PubChem (CID 71713668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).