About 3-[4-(1,2,4-triazol-1-yl)butoxy]benzamide
3-[4-(1,2,4-triazol-1-yl)butoxy]benzamide (PubChem CID 71713928) has the molecular formula C13H16N4O2
and a molecular weight of 260.30 g/mol. Its IUPAC name is 3-[4-(1,2,4-triazol-1-yl)butoxy]benzamide.
Molecular Properties
| Compound Name | 3-[4-(1,2,4-triazol-1-yl)butoxy]benzamide |
| PubChem CID | 71713928 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 3-[4-(1,2,4-triazol-1-yl)butoxy]benzamide |
| SMILES | NC(=O)c1cccc(OCCCCn2cncn2)c1 |
| InChI | InChI=1S/C13H16N4O2/c14-13(18)11-4-3-5-12(8-11)19-7-2-1-6-17-10-15-9-16-17/h3-5,8-10H,1-2,6-7H2,(H2,14,18) |
| InChIKey | QBLPRCXDLUJJPA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(1,2,4-triazol-1-yl)butoxy]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(1,2,4-triazol-1-yl)butoxy]benzamide?
The IUPAC name of 3-[4-(1,2,4-triazol-1-yl)butoxy]benzamide (CID 71713928) is 3-[4-(1,2,4-triazol-1-yl)butoxy]benzamide.
What is the SMILES notation for 3-[4-(1,2,4-triazol-1-yl)butoxy]benzamide?
The canonical SMILES for 3-[4-(1,2,4-triazol-1-yl)butoxy]benzamide is NC(=O)c1cccc(OCCCCn2cncn2)c1.
What is the InChIKey of 3-[4-(1,2,4-triazol-1-yl)butoxy]benzamide?
The InChIKey is QBLPRCXDLUJJPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O2/c14-13(18)11-4-3-5-12(8-11)19-7-2-1-6-17-10-15-9-16-17/h3-5,8-10H,1-2,6-7H2,(H2,14,18).
What are the key properties of 3-[4-(1,2,4-triazol-1-yl)butoxy]benzamide?
3-[4-(1,2,4-triazol-1-yl)butoxy]benzamide has a molecular weight of 260.30 g/mol, XLogP of 1.24, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(1,2,4-triazol-1-yl)butoxy]benzamide is sourced from PubChem (CID 71713928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).