C18H31NO2 — CID 71714011
(1S,2S,4aR,6R,8S,8aR)-N-methoxy-N,2,3,4a,6,8-hexamethyl-2,5,6,7,8,8a-hexahydro-1H-naphthalene-1-carboxamide (PubChem CID 71714011) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is (1S,2S,4aR,6R,8S,8aR)-N-methoxy-N,2,3,4a,6,8-hexamethyl-2,5,6,7,8,8a-hexahydro-1H-naphthalene-1-carboxamide.
| Compound Name | (1S,2S,4aR,6R,8S,8aR)-N-methoxy-N,2,3,4a,6,8-hexamethyl-2,5,6,7,8,8a-hexahydro-1H-naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 71714011 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | (1S,2S,4aR,6R,8S,8aR)-N-methoxy-N,2,3,4a,6,8-hexamethyl-2,5,6,7,8,8a-hexahydro-1H-naphthalene-1-carboxamide |
| SMILES | CON(C)C(=O)[C@@H]1[C@H]2[C@@H](C)C[C@@H](C)C[C@@]2(C)C=C(C)[C@H]1C |
| InChI | InChI=1S/C18H31NO2/c1-11-8-12(2)16-15(17(20)19(6)21-7)14(4)13(3)10-18(16,5)9-11/h10-12,14-16H,8-9H2,1-7H3/t11-,12+,14-,15+,16-,18+/m1/s1 |
| InChIKey | LKAJZAKSXVAPGG-OMEWIBDJSA-N |
| XLogP | 3.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|