C17H14O7 — CID 71714132
methyl [(11S,12S,16S)-9-oxo-8,13,17-trioxatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,14-pentaen-12-yl]methyl carbonate (PubChem CID 71714132) has the molecular formula C17H14O7 and a molecular weight of 330.29 g/mol. Its IUPAC name is methyl [(11S,12S,16S)-9-oxo-8,13,17-trioxatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,14-pentaen-12-yl]methyl carbonate.
| Compound Name | methyl [(11S,12S,16S)-9-oxo-8,13,17-trioxatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,14-pentaen-12-yl]methyl carbonate |
|---|---|
| PubChem CID | 71714132 |
| Molecular Formula | C17H14O7 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | methyl [(11S,12S,16S)-9-oxo-8,13,17-trioxatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,14-pentaen-12-yl]methyl carbonate |
| SMILES | COC(=O)OC[C@H]1OC=C[C@@H]2Oc3c(c(=O)oc4ccccc34)[C@@H]21 |
| InChI | InChI=1S/C17H14O7/c1-20-17(19)22-8-12-13-11(6-7-21-12)23-15-9-4-2-3-5-10(9)24-16(18)14(13)15/h2-7,11-13H,8H2,1H3/t11-,12+,13-/m0/s1 |
| InChIKey | MFWJUQVMFBMGIF-XQQFMLRXSA-N |
| XLogP | 2.33 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|