C32H28O10 — CID 71714321
[(3R,4S,5S,6S)-4,5-diacetyloxy-6-[4-(4-methoxyphenyl)-9,10-dioxoanthracen-1-yl]oxan-3-yl] acetate (PubChem CID 71714321) has the molecular formula C32H28O10 and a molecular weight of 572.57 g/mol. Its IUPAC name is [(3R,4S,5S,6S)-4,5-diacetyloxy-6-[4-(4-methoxyphenyl)-9,10-dioxoanthracen-1-yl]oxan-3-yl] acetate.
| Compound Name | [(3R,4S,5S,6S)-4,5-diacetyloxy-6-[4-(4-methoxyphenyl)-9,10-dioxoanthracen-1-yl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 71714321 |
| Molecular Formula | C32H28O10 |
| Molecular Weight | 572.57 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | [(3R,4S,5S,6S)-4,5-diacetyloxy-6-[4-(4-methoxyphenyl)-9,10-dioxoanthracen-1-yl]oxan-3-yl] acetate |
| SMILES | COc1ccc(-c2ccc([C@@H]3OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)c3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C32H28O10/c1-16(33)40-25-15-39-30(32(42-18(3)35)31(25)41-17(2)34)24-14-13-21(19-9-11-20(38-4)12-10-19)26-27(24)29(37)23-8-6-5-7-22(23)28(26)36/h5-14,25,30-32H,15H2,1-4H3/t25-,30+,31+,32+/m1/s1 |
| InChIKey | VQSLYCKGYSPWLW-YRPFWFDPSA-N |
| XLogP | 4.00 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|