C15H16O6 — CID 71714432
(1R,2S,6R,10R,11R)-10-hydroxy-2,6-dimethyl-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadec-4-ene-3,9,13-trione (PubChem CID 71714432) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is (1R,2S,6R,10R,11R)-10-hydroxy-2,6-dimethyl-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadec-4-ene-3,9,13-trione.
| Compound Name | (1R,2S,6R,10R,11R)-10-hydroxy-2,6-dimethyl-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadec-4-ene-3,9,13-trione |
|---|---|
| PubChem CID | 71714432 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | (1R,2S,6R,10R,11R)-10-hydroxy-2,6-dimethyl-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadec-4-ene-3,9,13-trione |
| SMILES | C[C@@H]1C(=O)C=C2[C@]13CC(=O)O[C@H](C3)[C@@]1(O)C(=O)OC[C@@]21C |
| InChI | InChI=1S/C15H16O6/c1-7-8(16)3-9-13(2)6-20-12(18)15(13,19)10-4-14(7,9)5-11(17)21-10/h3,7,10,19H,4-6H2,1-2H3/t7-,10-,13+,14-,15-/m1/s1 |
| InChIKey | OBPXIIQBMHEOHZ-LHUVKODFSA-N |
| XLogP | 0.13 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |