C19H26N4O4 — CID 71714654
4-[4-[[(5-methoxy-1H-indazole-3-carbonyl)amino]methyl]piperidin-1-yl]butanoic acid (PubChem CID 71714654) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 4-[4-[[(5-methoxy-1H-indazole-3-carbonyl)amino]methyl]piperidin-1-yl]butanoic acid.
| Compound Name | 4-[4-[[(5-methoxy-1H-indazole-3-carbonyl)amino]methyl]piperidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 71714654 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 4-[4-[[(5-methoxy-1H-indazole-3-carbonyl)amino]methyl]piperidin-1-yl]butanoic acid |
| SMILES | COc1ccc2[nH]nc(C(=O)NCC3CCN(CCCC(=O)O)CC3)c2c1 |
| InChI | InChI=1S/C19H26N4O4/c1-27-14-4-5-16-15(11-14)18(22-21-16)19(26)20-12-13-6-9-23(10-7-13)8-2-3-17(24)25/h4-5,11,13H,2-3,6-10,12H2,1H3,(H,20,26)(H,21,22)(H,24,25) |
| InChIKey | SHQBCBFQEAZMRA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |