C31H52BNO2Sn — CID 71714708
4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritert-butylstannylhex-1-enyl]benzonitrile (PubChem CID 71714708) has the molecular formula C31H52BNO2Sn and a molecular weight of 600.29 g/mol. Its IUPAC name is 4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritert-butylstannylhex-1-enyl]benzonitrile.
| Compound Name | 4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritert-butylstannylhex-1-enyl]benzonitrile |
|---|---|
| PubChem CID | 71714708 |
| Molecular Formula | C31H52BNO2Sn |
| Molecular Weight | 600.29 g/mol |
| Exact Mass | 601.31 |
| IUPAC Name | 4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritert-butylstannylhex-1-enyl]benzonitrile |
| SMILES | CCCC/C(B1OC(C)(C)C(C)(C)O1)=C(\c1ccc(C#N)cc1)[Sn](C(C)(C)C)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H25BNO2.3C4H9.Sn/c1-6-7-8-17(13-15-9-11-16(14-21)12-10-15)20-22-18(2,3)19(4,5)23-20;3*1-4(2)3;/h9-12H,6-8H2,1-5H3;3*1-3H3; |
| InChIKey | FLYLBCCTEOBGFE-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.29 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|