C31H33N5O2 — CID 71714953
methyl 2-(naphthalen-2-ylmethyl)-4-(3-piperidin-1-ylpropylamino)-9H-pyrimido[4,5-b]indole-7-carboxylate (PubChem CID 71714953) has the molecular formula C31H33N5O2 and a molecular weight of 507.64 g/mol. Its IUPAC name is methyl 2-(naphthalen-2-ylmethyl)-4-(3-piperidin-1-ylpropylamino)-9H-pyrimido[4,5-b]indole-7-carboxylate.
| Compound Name | methyl 2-(naphthalen-2-ylmethyl)-4-(3-piperidin-1-ylpropylamino)-9H-pyrimido[4,5-b]indole-7-carboxylate |
|---|---|
| PubChem CID | 71714953 |
| Molecular Formula | C31H33N5O2 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | methyl 2-(naphthalen-2-ylmethyl)-4-(3-piperidin-1-ylpropylamino)-9H-pyrimido[4,5-b]indole-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[nH]c1nc(Cc3ccc4ccccc4c3)nc(NCCCN3CCCCC3)c12 |
| InChI | InChI=1S/C31H33N5O2/c1-38-31(37)24-12-13-25-26(20-24)33-30-28(25)29(32-14-7-17-36-15-5-2-6-16-36)34-27(35-30)19-21-10-11-22-8-3-4-9-23(22)18-21/h3-4,8-13,18,20H,2,5-7,14-17,19H2,1H3,(H2,32,33,34,35) |
| InChIKey | KUGHXRARARVIGN-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|