C27H30FN5O2 — CID 71714970
methyl 2-[(3-fluorophenyl)methyl]-4-(3-piperidin-1-ylpropylamino)-9H-pyrimido[4,5-b]indole-7-carboxylate (PubChem CID 71714970) has the molecular formula C27H30FN5O2 and a molecular weight of 475.57 g/mol. Its IUPAC name is methyl 2-[(3-fluorophenyl)methyl]-4-(3-piperidin-1-ylpropylamino)-9H-pyrimido[4,5-b]indole-7-carboxylate.
| Compound Name | methyl 2-[(3-fluorophenyl)methyl]-4-(3-piperidin-1-ylpropylamino)-9H-pyrimido[4,5-b]indole-7-carboxylate |
|---|---|
| PubChem CID | 71714970 |
| Molecular Formula | C27H30FN5O2 |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | methyl 2-[(3-fluorophenyl)methyl]-4-(3-piperidin-1-ylpropylamino)-9H-pyrimido[4,5-b]indole-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[nH]c1nc(Cc3cccc(F)c3)nc(NCCCN3CCCCC3)c12 |
| InChI | InChI=1S/C27H30FN5O2/c1-35-27(34)19-9-10-21-22(17-19)30-26-24(21)25(29-11-6-14-33-12-3-2-4-13-33)31-23(32-26)16-18-7-5-8-20(28)15-18/h5,7-10,15,17H,2-4,6,11-14,16H2,1H3,(H2,29,30,31,32) |
| InChIKey | CVFBNPBDMIQURL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|