C29H30F3N5O3 — CID 71714973
methyl 4-(3-piperidin-1-ylpropylamino)-2-[[3-(2,2,2-trifluoroacetyl)phenyl]methyl]-9H-pyrimido[4,5-b]indole-7-carboxylate (PubChem CID 71714973) has the molecular formula C29H30F3N5O3 and a molecular weight of 553.59 g/mol. Its IUPAC name is methyl 4-(3-piperidin-1-ylpropylamino)-2-[[3-(2,2,2-trifluoroacetyl)phenyl]methyl]-9H-pyrimido[4,5-b]indole-7-carboxylate.
| Compound Name | methyl 4-(3-piperidin-1-ylpropylamino)-2-[[3-(2,2,2-trifluoroacetyl)phenyl]methyl]-9H-pyrimido[4,5-b]indole-7-carboxylate |
|---|---|
| PubChem CID | 71714973 |
| Molecular Formula | C29H30F3N5O3 |
| Molecular Weight | 553.59 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | methyl 4-(3-piperidin-1-ylpropylamino)-2-[[3-(2,2,2-trifluoroacetyl)phenyl]methyl]-9H-pyrimido[4,5-b]indole-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[nH]c1nc(Cc3cccc(C(=O)C(F)(F)F)c3)nc(NCCCN3CCCCC3)c12 |
| InChI | InChI=1S/C29H30F3N5O3/c1-40-28(39)20-9-10-21-22(17-20)34-27-24(21)26(33-11-6-14-37-12-3-2-4-13-37)35-23(36-27)16-18-7-5-8-19(15-18)25(38)29(30,31)32/h5,7-10,15,17H,2-4,6,11-14,16H2,1H3,(H2,33,34,35,36) |
| InChIKey | RLENUPAASQNUAH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|