C24H25N5O5S — CID 71715083
[(1R,2R,3S,4R)-2,3-dihydroxy-4-[[2-(3-phenylphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]cyclopentyl]methyl sulfamate (PubChem CID 71715083) has the molecular formula C24H25N5O5S and a molecular weight of 495.56 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-2,3-dihydroxy-4-[[2-(3-phenylphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]cyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2R,3S,4R)-2,3-dihydroxy-4-[[2-(3-phenylphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]cyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 71715083 |
| Molecular Formula | C24H25N5O5S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | [(1R,2R,3S,4R)-2,3-dihydroxy-4-[[2-(3-phenylphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]cyclopentyl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@H]1C[C@@H](Nc2ccnc3cc(-c4cccc(-c5ccccc5)c4)nn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H25N5O5S/c25-35(32,33)34-14-18-12-20(24(31)23(18)30)27-21-9-10-26-22-13-19(28-29(21)22)17-8-4-7-16(11-17)15-5-2-1-3-6-15/h1-11,13,18,20,23-24,27,30-31H,12,14H2,(H2,25,32,33)/t18-,20-,23-,24+/m1/s1 |
| InChIKey | OHUBWOCZKZLWIV-ILEGPTGMSA-N |
| XLogP | 1.81 |
| TPSA | 152.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |