C22H15F6N3O4S — CID 71715135
2-[6-[4-[(6-amino-3-pyridinyl)sulfonyl]phenyl]-5-(3-hydroxyprop-1-ynyl)-3-pyridinyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 71715135) has the molecular formula C22H15F6N3O4S and a molecular weight of 531.43 g/mol. Its IUPAC name is 2-[6-[4-[(6-amino-3-pyridinyl)sulfonyl]phenyl]-5-(3-hydroxyprop-1-ynyl)-3-pyridinyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[6-[4-[(6-amino-3-pyridinyl)sulfonyl]phenyl]-5-(3-hydroxyprop-1-ynyl)-3-pyridinyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 71715135 |
| Molecular Formula | C22H15F6N3O4S |
| Molecular Weight | 531.43 g/mol |
| Exact Mass | 531.07 |
| IUPAC Name | 2-[6-[4-[(6-amino-3-pyridinyl)sulfonyl]phenyl]-5-(3-hydroxyprop-1-ynyl)-3-pyridinyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Nc1ccc(S(=O)(=O)c2ccc(-c3ncc(C(O)(C(F)(F)F)C(F)(F)F)cc3C#CCO)cc2)cn1 |
| InChI | InChI=1S/C22H15F6N3O4S/c23-21(24,25)20(33,22(26,27)28)15-10-14(2-1-9-32)19(31-11-15)13-3-5-16(6-4-13)36(34,35)17-7-8-18(29)30-12-17/h3-8,10-12,32-33H,9H2,(H2,29,30) |
| InChIKey | QDURMADQEYTVDK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|