C17H20N6O5S — CID 71715144
[(1R,2R,3S,4R)-2,3-dihydroxy-4-[(2-pyridin-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]cyclopentyl]methyl sulfamate (PubChem CID 71715144) has the molecular formula C17H20N6O5S and a molecular weight of 420.45 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-2,3-dihydroxy-4-[(2-pyridin-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]cyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2R,3S,4R)-2,3-dihydroxy-4-[(2-pyridin-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]cyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 71715144 |
| Molecular Formula | C17H20N6O5S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | [(1R,2R,3S,4R)-2,3-dihydroxy-4-[(2-pyridin-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]cyclopentyl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@H]1C[C@@H](Nc2ccnc3cc(-c4ccccn4)nn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H20N6O5S/c18-29(26,27)28-9-10-7-13(17(25)16(10)24)21-14-4-6-20-15-8-12(22-23(14)15)11-3-1-2-5-19-11/h1-6,8,10,13,16-17,21,24-25H,7,9H2,(H2,18,26,27)/t10-,13-,16-,17+/m1/s1 |
| InChIKey | XDXPCTFDYJMPLE-IXZQUYOESA-N |
| XLogP | -0.47 |
| TPSA | 164.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |